C9H11ClFN3O3 — CID 14632484
4-amino-5-chloro-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 14632484) has the molecular formula C9H11ClFN3O3 and a molecular weight of 263.66 g/mol. Its IUPAC name is 4-amino-5-chloro-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-chloro-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 14632484 |
| Molecular Formula | C9H11ClFN3O3 |
| Molecular Weight | 263.66 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-amino-5-chloro-1-[4-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n(C2CC(F)C(CO)O2)cc1Cl |
| InChI | InChI=1S/C9H11ClFN3O3/c10-4-2-14(9(16)13-8(4)12)7-1-5(11)6(3-15)17-7/h2,5-7,15H,1,3H2,(H2,12,13,16) |
| InChIKey | DKTULUNJRRRNTA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.66 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |