C10H14FN3O4 — CID 5274089
1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)-5-methylpyrimidin-2-one (PubChem CID 5274089) has the molecular formula C10H14FN3O4 and a molecular weight of 259.24 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)-5-methylpyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 5274089 |
| Molecular Formula | C10H14FN3O4 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)-5-methylpyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@H](CO)O2)c(=O)nc1NO |
| InChI | InChI=1S/C10H14FN3O4/c1-5-3-14(10(16)12-9(5)13-17)8-2-6(11)7(4-15)18-8/h3,6-8,15,17H,2,4H2,1H3,(H,12,13,16)/t6-,7+,8+/m0/s1 |
| InChIKey | TXCTVUKWPQTUAW-XLPZGREQSA-N |
| XLogP | -0.03 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|