C10H14FN3O5 — CID 174063487
5-fluoro-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methoxyamino)pyrimidin-2-one (PubChem CID 174063487) has the molecular formula C10H14FN3O5 and a molecular weight of 275.24 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methoxyamino)pyrimidin-2-one.
| Compound Name | 5-fluoro-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methoxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 174063487 |
| Molecular Formula | C10H14FN3O5 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-fluoro-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methoxyamino)pyrimidin-2-one |
| SMILES | CONc1nc(=O)n([C@H]2CC(O)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/C10H14FN3O5/c1-18-13-9-5(11)3-14(10(17)12-9)8-2-6(16)7(4-15)19-8/h3,6-8,15-16H,2,4H2,1H3,(H,12,13,17)/t6?,7-,8-/m1/s1 |
| InChIKey | WWRMUNRCYPFJMG-SPDVFEMOSA-N |
| XLogP | -1.00 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|