C9H12FN3O4 — CID 56624884
1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 56624884) has the molecular formula C9H12FN3O4 and a molecular weight of 245.21 g/mol. Its IUPAC name is 1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 56624884 |
| Molecular Formula | C9H12FN3O4 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-[(2S,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | O=c1nc(NO)ccn1[C@@H]1C[C@H](F)[C@@H](CO)O1 |
| InChI | InChI=1S/C9H12FN3O4/c10-5-3-8(17-6(5)4-14)13-2-1-7(12-16)11-9(13)15/h1-2,5-6,8,14,16H,3-4H2,(H,11,12,15)/t5-,6+,8-/m0/s1 |
| InChIKey | ZVAQUCFETNYFQI-BBVRLYRLSA-N |
| XLogP | -0.34 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|