C10H14FN3O5 — CID 22859290
1-[(2R,4S,5R)-5-[(1S)-1,2-dihydroxyethyl]-4-fluorooxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 22859290) has the molecular formula C10H14FN3O5 and a molecular weight of 275.24 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[(1S)-1,2-dihydroxyethyl]-4-fluorooxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-5-[(1S)-1,2-dihydroxyethyl]-4-fluorooxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 22859290 |
| Molecular Formula | C10H14FN3O5 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[(1S)-1,2-dihydroxyethyl]-4-fluorooxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | O=c1nc(NO)ccn1[C@H]1C[C@H](F)[C@@H]([C@@H](O)CO)O1 |
| InChI | InChI=1S/C10H14FN3O5/c11-5-3-8(19-9(5)6(16)4-15)14-2-1-7(13-18)12-10(14)17/h1-2,5-6,8-9,15-16,18H,3-4H2,(H,12,13,17)/t5-,6-,8+,9-/m0/s1 |
| InChIKey | QKXCCCXSSJAXNH-ITFKJWCVSA-N |
| XLogP | -0.98 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|