C15H25N5O5 — CID 142604126
[5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2,6-diaminohexanoate (PubChem CID 142604126) has the molecular formula C15H25N5O5 and a molecular weight of 355.40 g/mol. Its IUPAC name is [5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2,6-diaminohexanoate.
| Compound Name | [5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 142604126 |
| Molecular Formula | C15H25N5O5 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2,6-diaminohexanoate |
| SMILES | NCCCCC(N)C(=O)OCC1CCC(n2ccc(NO)nc2=O)O1 |
| InChI | InChI=1S/C15H25N5O5/c16-7-2-1-3-11(17)14(21)24-9-10-4-5-13(25-10)20-8-6-12(19-23)18-15(20)22/h6,8,10-11,13,23H,1-5,7,9,16-17H2,(H,18,19,22) |
| InChIKey | XJCYFUZJPVUUOL-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|