C15H28N4O8 — CID 156825372
[5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2-amino-3-hydroxybutanoate;methanol (PubChem CID 156825372) has the molecular formula C15H28N4O8 and a molecular weight of 392.41 g/mol. Its IUPAC name is [5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2-amino-3-hydroxybutanoate;methanol.
| Compound Name | [5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2-amino-3-hydroxybutanoate;methanol |
|---|---|
| PubChem CID | 156825372 |
| Molecular Formula | C15H28N4O8 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]oxolan-2-yl]methyl 2-amino-3-hydroxybutanoate;methanol |
| SMILES | CC(O)C(N)C(=O)OCC1CCC(n2ccc(NO)nc2=O)O1.CO.CO |
| InChI | InChI=1S/C13H20N4O6.2CH4O/c1-7(18)11(14)12(19)22-6-8-2-3-10(23-8)17-5-4-9(16-21)15-13(17)20;2*1-2/h4-5,7-8,10-11,18,21H,2-3,6,14H2,1H3,(H,15,16,20);2*2H,1H3 |
| InChIKey | ILEHRSITXBSRJK-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|