C15H23N3O4 — CID 162940499
N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbutanamide (PubChem CID 162940499) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbutanamide.
| Compound Name | N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 162940499 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccn(C2CCC(O)C(C)O2)c(=O)n1 |
| InChI | InChI=1S/C15H23N3O4/c1-9(2)8-13(20)16-12-6-7-18(15(21)17-12)14-5-4-11(19)10(3)22-14/h6-7,9-11,14,19H,4-5,8H2,1-3H3,(H,16,17,20,21) |
| InChIKey | JHEDAHBBVHHXFP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |