C36H56N3O7P — CID 53382096
[(2S,5R)-5-[2-oxo-4-[[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 53382096) has the molecular formula C36H56N3O7P and a molecular weight of 673.83 g/mol. Its IUPAC name is [(2S,5R)-5-[2-oxo-4-[[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,5R)-5-[2-oxo-4-[[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 53382096 |
| Molecular Formula | C36H56N3O7P |
| Molecular Weight | 673.83 g/mol |
| Exact Mass | 673.39 |
| IUPAC Name | [(2S,5R)-5-[2-oxo-4-[[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoyl]amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC(=O)Nc1ccn([C@H]2CC[C@@H](COP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C36H56N3O7P/c1-27(2)12-9-15-30(5)18-10-16-28(3)13-7-8-14-29(4)17-11-19-31(6)20-22-34(40)37-33-24-25-39(36(41)38-33)35-23-21-32(46-35)26-45-47(42,43)44/h12-14,18-19,24-25,32,35H,7-11,15-17,20-23,26H2,1-6H3,(H2,42,43,44)(H,37,38,40,41)/b28-13+,29-14+,30-18+,31-19+/t32-,35+/m0/s1 |
| InChIKey | JRXHCGZJZQXPGN-WIEJZORSSA-N |
| XLogP | 8.62 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.83 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|