C53H73N3O5 — CID 123422416
N-[2-oxo-1-[(5S)-5-(3-oxodocosa-4,7,10,13,16,19-hexaenoxymethyl)oxolan-2-yl]pyrimidin-4-yl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 123422416) has the molecular formula C53H73N3O5 and a molecular weight of 832.18 g/mol. Its IUPAC name is N-[2-oxo-1-[(5S)-5-(3-oxodocosa-4,7,10,13,16,19-hexaenoxymethyl)oxolan-2-yl]pyrimidin-4-yl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | N-[2-oxo-1-[(5S)-5-(3-oxodocosa-4,7,10,13,16,19-hexaenoxymethyl)oxolan-2-yl]pyrimidin-4-yl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 123422416 |
| Molecular Formula | C53H73N3O5 |
| Molecular Weight | 832.18 g/mol |
| Exact Mass | 831.56 |
| IUPAC Name | N-[2-oxo-1-[(5S)-5-(3-oxodocosa-4,7,10,13,16,19-hexaenoxymethyl)oxolan-2-yl]pyrimidin-4-yl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)Nc1ccn(C2CC[C@@H](COCCC(=O)C=CCC=CCC=CCC=CCC=CCC=CCC)O2)c(=O)n1 |
| InChI | InChI=1S/C53H73N3O5/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-51(58)54-50-43-45-56(53(59)55-50)52-42-41-49(61-52)47-60-46-44-48(57)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,22,24-25,27-28,30-31,33-34,36-37,39,43,45,49,52H,3-4,9-10,15-16,21,23,26,29,32,35,38,40-42,44,46-47H2,1-2H3,(H,54,55,58,59)/t49-,52?/m0/s1 |
| InChIKey | ABFADEQUKBPBMI-ZRUUAWBYSA-N |
| XLogP | 13.01 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.18 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|