C33H52N5O5P — CID 144762834
(5Z,8Z,11Z,14Z,17Z)-N-[2-[[ethoxy-[[5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy]phosphanyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 144762834) has the molecular formula C33H52N5O5P and a molecular weight of 629.78 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-[[ethoxy-[[5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy]phosphanyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[[ethoxy-[[5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy]phosphanyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 144762834 |
| Molecular Formula | C33H52N5O5P |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.37 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[[ethoxy-[[5-(4-methyl-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy]phosphanyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCNP(OCC)OCC1CCC(n2cnc(C)nc2=O)O1 |
| InChI | InChI=1S/C33H52N5O5P/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-31(39)34-25-26-36-44(41-5-2)42-27-30-23-24-32(43-30)38-28-35-29(3)37-33(38)40/h6-7,9-10,12-13,15-16,18-19,28,30,32,36H,4-5,8,11,14,17,20-27H2,1-3H3,(H,34,39)/b7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | UQPLBIOKJVQXQB-WMPRHZDHSA-N |
| XLogP | 6.53 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|