C15H20N5O4P — CID 145155260
4-amino-1-[5-[[methylamino(phenoxy)phosphanyl]oxymethyl]oxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 145155260) has the molecular formula C15H20N5O4P and a molecular weight of 365.33 g/mol. Its IUPAC name is 4-amino-1-[5-[[methylamino(phenoxy)phosphanyl]oxymethyl]oxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[5-[[methylamino(phenoxy)phosphanyl]oxymethyl]oxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 145155260 |
| Molecular Formula | C15H20N5O4P |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-amino-1-[5-[[methylamino(phenoxy)phosphanyl]oxymethyl]oxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | CNP(OCC1CCC(n2cnc(N)nc2=O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C15H20N5O4P/c1-17-25(24-11-5-3-2-4-6-11)22-9-12-7-8-13(23-12)20-10-18-14(16)19-15(20)21/h2-6,10,12-13,17H,7-9H2,1H3,(H2,16,19,21) |
| InChIKey | NRRQBMIYELEGOC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|