C24H30N5O5P — CID 166919732
cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 166919732) has the molecular formula C24H30N5O5P and a molecular weight of 499.51 g/mol. Its IUPAC name is cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 166919732 |
| Molecular Formula | C24H30N5O5P |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | CC(NP(OCC1CCC(c2ccc3c(N)ncnn23)O1)Oc1ccccc1)C(=O)OC1CCC1 |
| InChI | InChI=1S/C24H30N5O5P/c1-16(24(30)33-17-8-5-9-17)28-35(34-18-6-3-2-4-7-18)31-14-19-10-13-22(32-19)20-11-12-21-23(25)26-15-27-29(20)21/h2-4,6-7,11-12,15-17,19,22,28H,5,8-10,13-14H2,1H3,(H2,25,26,27) |
| InChIKey | DJLOBHGQVJKDMV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|