C24H30N5O6P — CID 166862518
cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166862518) has the molecular formula C24H30N5O6P and a molecular weight of 515.51 g/mol. Its IUPAC name is cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166862518 |
| Molecular Formula | C24H30N5O6P |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | cyclobutyl 2-[[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1CCC(c2ccc3c(N)ncnn23)O1)Oc1ccccc1)C(=O)OC1CCC1 |
| InChI | InChI=1S/C24H30N5O6P/c1-16(24(30)34-17-8-5-9-17)28-36(31,35-18-6-3-2-4-7-18)32-14-19-10-13-22(33-19)20-11-12-21-23(25)26-15-27-29(20)21/h2-4,6-7,11-12,15-17,19,22H,5,8-10,13-14H2,1H3,(H,28,31)(H2,25,26,27) |
| InChIKey | JFYAUWFZZLJZGC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 139.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|