C10H14N5O4PS — CID 170608283
[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-sulfanylphosphinous acid (PubChem CID 170608283) has the molecular formula C10H14N5O4PS and a molecular weight of 331.29 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-sulfanylphosphinous acid.
| Compound Name | [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-sulfanylphosphinous acid |
|---|---|
| PubChem CID | 170608283 |
| Molecular Formula | C10H14N5O4PS |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-sulfanylphosphinous acid |
| SMILES | Nc1nc2c(ncn2[C@H]2CC[C@@H](COP(O)S)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O4PS/c11-10-13-8-7(9(16)14-10)12-4-15(8)6-2-1-5(19-6)3-18-20(17)21/h4-6,17,21H,1-3H2,(H3,11,13,14,16)/t5-,6+,20?/m0/s1 |
| InChIKey | UBEINFGPSVDJAT-UXFVGQHFSA-N |
| XLogP | 0.55 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|