C10H13N5O5P+ — CID 137081386
[5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 137081386) has the molecular formula C10H13N5O5P+ and a molecular weight of 314.22 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 137081386 |
| Molecular Formula | C10H13N5O5P+ |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | Nc1nc2c(ncn2C2CCC(CO[P+](=O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N5O5P/c11-10-13-8-7(9(16)14-10)12-4-15(8)6-2-1-5(20-6)3-19-21(17)18/h4-6H,1-3H2,(H3-,11,13,14,16,17,18)/p+1 |
| InChIKey | HGIQEIONHWDUKR-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|