C11H16N5O3P — CID 142386439
2-amino-9-[5-(methylphosphanyloxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 142386439) has the molecular formula C11H16N5O3P and a molecular weight of 297.26 g/mol. Its IUPAC name is 2-amino-9-[5-(methylphosphanyloxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[5-(methylphosphanyloxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 142386439 |
| Molecular Formula | C11H16N5O3P |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-amino-9-[5-(methylphosphanyloxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CPOCC1CCC(n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C11H16N5O3P/c1-20-18-4-6-2-3-7(19-6)16-5-13-8-9(16)14-11(12)15-10(8)17/h5-7,20H,2-4H2,1H3,(H3,12,14,15,17) |
| InChIKey | LAHWGYBDBANXFM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|