C10H15N7O2 — CID 137213095
2-amino-9-[(2R,5S)-5-(hydrazinylmethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 137213095) has the molecular formula C10H15N7O2 and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-amino-9-[(2R,5S)-5-(hydrazinylmethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,5S)-5-(hydrazinylmethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137213095 |
| Molecular Formula | C10H15N7O2 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-amino-9-[(2R,5S)-5-(hydrazinylmethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | NNC[C@@H]1CC[C@H](n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C10H15N7O2/c11-10-15-8-7(9(18)16-10)13-4-17(8)6-2-1-5(19-6)3-14-12/h4-6,14H,1-3,12H2,(H3,11,15,16,18)/t5-,6+/m0/s1 |
| InChIKey | HXOVCNSLTCNDMV-NTSWFWBYSA-N |
| XLogP | -1.16 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|