C10H14N6O3 — CID 135565717
2-amino-9-[(2R,6S)-6-(hydroxymethyl)morpholin-2-yl]-1H-purin-6-one (PubChem CID 135565717) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-amino-9-[(2R,6S)-6-(hydroxymethyl)morpholin-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,6S)-6-(hydroxymethyl)morpholin-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135565717 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-amino-9-[(2R,6S)-6-(hydroxymethyl)morpholin-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2CNC[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N6O3/c11-10-14-8-7(9(18)15-10)13-4-16(8)6-2-12-1-5(3-17)19-6/h4-6,12,17H,1-3H2,(H3,11,14,15,18)/t5-,6+/m0/s1 |
| InChIKey | KPTLNRLVEMSHSQ-NTSWFWBYSA-N |
| XLogP | -1.82 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |