C14H21ClN6O10P2 — CID 155014470
[[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate (PubChem CID 155014470) has the molecular formula C14H21ClN6O10P2 and a molecular weight of 530.76 g/mol. Its IUPAC name is [[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 155014470 |
| Molecular Formula | C14H21ClN6O10P2 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | [[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2CC[C@@H](COP(=O)(O)OP(=O)(O)OCCNC(=O)CCl)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H21ClN6O10P2/c15-5-9(22)17-3-4-28-32(24,25)31-33(26,27)29-6-8-1-2-10(30-8)21-7-18-11-12(21)19-14(16)20-13(11)23/h7-8,10H,1-6H2,(H,17,22)(H,24,25)(H,26,27)(H3,16,19,20,23)/t8-,10+/m0/s1 |
| InChIKey | FSYWNJWRIHKBHU-WCBMZHEXSA-N |
| XLogP | -0.01 |
| TPSA | 230.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|