C14H20ClN6O8P — CID 136994261
[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate (PubChem CID 136994261) has the molecular formula C14H20ClN6O8P and a molecular weight of 466.78 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 136994261 |
| Molecular Formula | C14H20ClN6O8P |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 2-[(2-chloroacetyl)amino]ethyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OCCNC(=O)CCl)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H20ClN6O8P/c15-4-9(23)17-1-2-27-30(25,26)28-5-8-7(22)3-10(29-8)21-6-18-11-12(21)19-14(16)20-13(11)24/h6-8,10,22H,1-5H2,(H,17,23)(H,25,26)(H3,16,19,20,24)/t7-,8-,10-/m1/s1 |
| InChIKey | LNENEDZTIPVYFU-NQMVMOMDSA-N |
| XLogP | -1.16 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|