C11H17N8O13P3 — CID 175032329
[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [azidomethoxy(hydroxy)phosphoryl] hydrogen phosphate (PubChem CID 175032329) has the molecular formula C11H17N8O13P3 and a molecular weight of 562.22 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [azidomethoxy(hydroxy)phosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [azidomethoxy(hydroxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 175032329 |
| Molecular Formula | C11H17N8O13P3 |
| Molecular Weight | 562.22 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | [[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [azidomethoxy(hydroxy)phosphoryl] hydrogen phosphate |
| SMILES | [N-]=[N+]=NCOP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@@H]1O |
| InChI | InChI=1S/C11H17N8O13P3/c12-11-16-9-8(10(21)17-11)14-3-19(9)7-1-5(20)6(30-7)2-28-33(22,23)31-35(26,27)32-34(24,25)29-4-15-18-13/h3,5-7,20H,1-2,4H2,(H,22,23)(H,24,25)(H,26,27)(H3,12,16,17,21)/t5-,6+,7+/m0/s1 |
| InChIKey | NFVSBXBVRLJROJ-RRKCRQDMSA-N |
| XLogP | -0.01 |
| TPSA | 316.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|