C15H21N6O7P — CID 136994240
[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-(prop-2-enoylamino)ethyl hydrogen phosphate (PubChem CID 136994240) has the molecular formula C15H21N6O7P and a molecular weight of 428.34 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-(prop-2-enoylamino)ethyl hydrogen phosphate.
| Compound Name | [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-(prop-2-enoylamino)ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 136994240 |
| Molecular Formula | C15H21N6O7P |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 2-(prop-2-enoylamino)ethyl hydrogen phosphate |
| SMILES | C=CC(=O)NCCOP(=O)(O)OC[C@@H]1CC[C@H](n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C15H21N6O7P/c1-2-10(22)17-5-6-26-29(24,25)27-7-9-3-4-11(28-9)21-8-18-12-13(21)19-15(16)20-14(12)23/h2,8-9,11H,1,3-7H2,(H,17,22)(H,24,25)(H3,16,19,20,23)/t9-,11+/m0/s1 |
| InChIKey | JVCULVNMELSZSR-GXSJLCMTSA-N |
| XLogP | -0.18 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|