C19H25N10O10P — CID 136645485
[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methyl carbamate (PubChem CID 136645485) has the molecular formula C19H25N10O10P and a molecular weight of 584.44 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methyl carbamate.
| Compound Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 136645485 |
| Molecular Formula | C19H25N10O10P |
| Molecular Weight | 584.44 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@H]1OP(=O)(O)OC[C@@H]1CC[C@H](n2cnc(N)nc2=O)O1 |
| InChI | InChI=1S/C19H25N10O10P/c20-16-24-7-29(19(32)27-16)11-2-1-8(37-11)4-36-40(33,34)39-9-3-12(38-10(9)5-35-18(22)31)28-6-23-13-14(28)25-17(21)26-15(13)30/h6-12H,1-5H2,(H2,22,31)(H,33,34)(H2,20,27,32)(H3,21,25,26,30)/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | UKCMEZSTBYWUML-VSSNEEPJSA-N |
| XLogP | -1.50 |
| TPSA | 289.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.44 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|