C22H28N9O12P — CID 144545342
[(2R,5R)-3-[[(2R,5R)-3-acetyloxy-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 144545342) has the molecular formula C22H28N9O12P and a molecular weight of 641.49 g/mol. Its IUPAC name is [(2R,5R)-3-[[(2R,5R)-3-acetyloxy-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,5R)-3-[[(2R,5R)-3-acetyloxy-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 144545342 |
| Molecular Formula | C22H28N9O12P |
| Molecular Weight | 641.49 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | [(2R,5R)-3-[[(2R,5R)-3-acetyloxy-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)CC1OP(=O)(O)OC[C@H]1O[C@@H](n2cnc(N)nc2=O)CC1OC(C)=O |
| InChI | InChI=1S/C22H28N9O12P/c1-9(32)38-5-13-12(4-15(41-13)30-7-25-17-18(30)27-21(24)28-19(17)34)43-44(36,37)39-6-14-11(40-10(2)33)3-16(42-14)31-8-26-20(23)29-22(31)35/h7-8,11-16H,3-6H2,1-2H3,(H,36,37)(H2,23,29,35)(H3,24,27,28,34)/t11?,12?,13-,14-,15-,16-/m1/s1 |
| InChIKey | UMDYLIPGKQQCNT-XJIVYGFWSA-N |
| XLogP | -1.49 |
| TPSA | 290.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.49 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|