About 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one
9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136592210) has the molecular formula C11H14N4O3
and a molecular weight of 250.26 g/mol. Its IUPAC name is 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one.
Molecular Properties
| Compound Name | 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one |
| PubChem CID | 136592210 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | COC[C@@H]1CC[C@H](n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C11H14N4O3/c1-17-4-7-2-3-8(18-7)15-6-14-9-10(15)12-5-13-11(9)16/h5-8H,2-4H2,1H3,(H,12,13,16)/t7-,8+/m0/s1 |
| InChIKey | IBLDYNTUNJUXCG-JGVFFNPUSA-N |
| XLogP | 0.44 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one?
The IUPAC name of 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one (CID 136592210) is 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one.
What is the SMILES notation for 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one?
The canonical SMILES for 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one is COC[C@@H]1CC[C@H](n2cnc3c(=O)[nH]cnc32)O1.
What is the InChIKey of 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one?
The InChIKey is IBLDYNTUNJUXCG-JGVFFNPUSA-N. The full InChI is InChI=1S/C11H14N4O3/c1-17-4-7-2-3-8(18-7)15-6-14-9-10(15)12-5-13-11(9)16/h5-8H,2-4H2,1H3,(H,12,13,16)/t7-,8+/m0/s1.
What are the key properties of 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one?
9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one has a molecular weight of 250.26 g/mol, XLogP of 0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one is sourced from PubChem (CID 136592210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).