C11H14N4O3 — CID 136592210
9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 136592210) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136592210 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 9-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | COC[C@@H]1CC[C@H](n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C11H14N4O3/c1-17-4-7-2-3-8(18-7)15-6-14-9-10(15)12-5-13-11(9)16/h5-8H,2-4H2,1H3,(H,12,13,16)/t7-,8+/m0/s1 |
| InChIKey | IBLDYNTUNJUXCG-JGVFFNPUSA-N |
| XLogP | 0.44 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |