C35H51N6O6P — CID 136592648
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[methoxy-[[(2S)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 136592648) has the molecular formula C35H51N6O6P and a molecular weight of 682.80 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[methoxy-[[(2S)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[methoxy-[[(2S)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 136592648 |
| Molecular Formula | C35H51N6O6P |
| Molecular Weight | 682.80 g/mol |
| Exact Mass | 682.36 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[[methoxy-[[(2S)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNP(=O)(OC)OC[C@@H]1CCC(n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C35H51N6O6P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-31(42)36-25-26-40-48(44,45-2)46-27-30-23-24-32(47-30)41-29-39-33-34(41)37-28-38-35(33)43/h4-5,7-8,10-11,13-14,16-17,19-20,28-30,32H,3,6,9,12,15,18,21-27H2,1-2H3,(H,36,42)(H,40,44)(H,37,38,43)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-/t30-,32?,48?/m0/s1 |
| InChIKey | NOBUJBZPTNTIOE-XMDKVAEVSA-N |
| XLogP | 6.75 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.80 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|