C34H55N6O6PS2 — CID 144762927
(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-ethoxyphosphoryl]amino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 144762927) has the molecular formula C34H55N6O6PS2 and a molecular weight of 738.96 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-ethoxyphosphoryl]amino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-ethoxyphosphoryl]amino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 144762927 |
| Molecular Formula | C34H55N6O6PS2 |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[[[5-(4-amino-2-oxo-1,3,5-triazin-1-yl)oxolan-2-yl]methoxy-ethoxyphosphoryl]amino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCSSCCNP(=O)(OCC)OCC1CCC(n2cnc(N)nc2=O)O1 |
| InChI | InChI=1S/C34H55N6O6PS2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-31(41)36-24-26-48-49-27-25-38-47(43,44-4-2)45-28-30-22-23-32(46-30)40-29-37-33(35)39-34(40)42/h5-6,8-9,11-12,14-15,17-18,29-30,32H,3-4,7,10,13,16,19-28H2,1-2H3,(H,36,41)(H,38,43)(H2,35,39,42)/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | SXRRYZIIEYPMCZ-AAQCHOMXSA-N |
| XLogP | 7.07 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|