C27H44N2O3S2 — CID 123489853
ethyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]carbamate (PubChem CID 123489853) has the molecular formula C27H44N2O3S2 and a molecular weight of 508.79 g/mol. Its IUPAC name is ethyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]carbamate.
| Compound Name | ethyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 123489853 |
| Molecular Formula | C27H44N2O3S2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | ethyl N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]carbamate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCSSCCNC(=O)OCC |
| InChI | InChI=1S/C27H44N2O3S2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(30)28-22-24-33-34-25-23-29-27(31)32-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-25H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | YLODXVKBJPBXSR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|