C31H44N2O5S2 — CID 123814504
3,4,5-trihydroxy-N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]benzamide (PubChem CID 123814504) has the molecular formula C31H44N2O5S2 and a molecular weight of 588.84 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 123814504 |
| Molecular Formula | C31H44N2O5S2 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 3,4,5-trihydroxy-N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyldisulfanyl]ethyl]benzamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCSSCCNC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C31H44N2O5S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-29(36)32-20-22-39-40-23-21-33-31(38)26-24-27(34)30(37)28(35)25-26/h3-4,6-7,9-10,12-13,15-16,24-25,34-35,37H,2,5,8,11,14,17-23H2,1H3,(H,32,36)(H,33,38) |
| InChIKey | MQBFXQAKBGLWKM-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|