C33H46N2O2S2 — CID 118539446
N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]ethyl]benzamide (PubChem CID 118539446) has the molecular formula C33H46N2O2S2 and a molecular weight of 566.88 g/mol. Its IUPAC name is N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]ethyl]benzamide.
| Compound Name | N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 118539446 |
| Molecular Formula | C33H46N2O2S2 |
| Molecular Weight | 566.88 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | N-[2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]ethyl]benzamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCSSCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H46N2O2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26-32(36)34-27-29-38-39-30-28-35-33(37)31-24-21-20-22-25-31/h3-4,6-7,9-10,12-13,15-16,18-22,24-25H,2,5,8,11,14,17,23,26-30H2,1H3,(H,34,36)(H,35,37)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | JYEFKSHVOAPOPJ-KUBAVDMBSA-N |
| XLogP | 8.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.88 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|