C36H52N4O4S2 — CID 130405441
[(2R)-3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]-3-methyl-2-(pyridine-3-carbonylamino)butyl]carbamic acid (PubChem CID 130405441) has the molecular formula C36H52N4O4S2 and a molecular weight of 668.97 g/mol. Its IUPAC name is [(2R)-3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]-3-methyl-2-(pyridine-3-carbonylamino)butyl]carbamic acid.
| Compound Name | [(2R)-3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]-3-methyl-2-(pyridine-3-carbonylamino)butyl]carbamic acid |
|---|---|
| PubChem CID | 130405441 |
| Molecular Formula | C36H52N4O4S2 |
| Molecular Weight | 668.97 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | [(2R)-3-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyldisulfanyl]-3-methyl-2-(pyridine-3-carbonylamino)butyl]carbamic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCSSC(C)(C)[C@@H](CNC(=O)O)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C36H52N4O4S2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-33(41)38-27-28-45-46-36(2,3)32(30-39-35(43)44)40-34(42)31-24-23-26-37-29-31/h5-6,8-9,11-12,14-15,17-18,20-21,23-24,26,29,32,39H,4,7,10,13,16,19,22,25,27-28,30H2,1-3H3,(H,38,41)(H,40,42)(H,43,44)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-/t32-/m1/s1 |
| InChIKey | SFDYQPJWHVAIFM-WNKBAKDSSA-N |
| XLogP | 8.20 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.97 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|