C33H48N4O3 — CID 123414616
N-[1-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]pyridine-3-carboxamide (PubChem CID 123414616) has the molecular formula C33H48N4O3 and a molecular weight of 548.77 g/mol. Its IUPAC name is N-[1-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123414616 |
| Molecular Formula | C33H48N4O3 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | N-[1-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethylamino]-3-methyl-1-oxobutan-2-yl]pyridine-3-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCNC(=O)C(NC(=O)c1cccnc1)C(C)C |
| InChI | InChI=1S/C33H48N4O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-30(38)35-25-26-36-33(40)31(28(2)3)37-32(39)29-22-21-24-34-27-29/h5-6,8-9,11-12,14-15,17-18,21-22,24,27-28,31H,4,7,10,13,16,19-20,23,25-26H2,1-3H3,(H,35,38)(H,36,40)(H,37,39) |
| InChIKey | TZOCXOMXJFYKTC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|