C30H43N3O2 — CID 123426220
N-[4-(icosa-5,8,11,14,17-pentaenoylamino)butyl]pyridine-3-carboxamide (PubChem CID 123426220) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is N-[4-(icosa-5,8,11,14,17-pentaenoylamino)butyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(icosa-5,8,11,14,17-pentaenoylamino)butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123426220 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | N-[4-(icosa-5,8,11,14,17-pentaenoylamino)butyl]pyridine-3-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C30H43N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-29(34)32-25-19-20-26-33-30(35)28-22-21-24-31-27-28/h3-4,6-7,9-10,12-13,15-16,21-22,24,27H,2,5,8,11,14,17-20,23,25-26H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | KJCVFYADVVYAPU-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|