C27H38N4O2 — CID 123694479
N-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyl]pyrimidine-4-carboxamide (PubChem CID 123694479) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is N-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyl]pyrimidine-4-carboxamide.
| Compound Name | N-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123694479 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | N-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethyl]pyrimidine-4-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCNC(=O)c1ccncn1 |
| InChI | InChI=1S/C27H38N4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(32)29-22-23-30-27(33)25-20-21-28-24-31-25/h3-4,6-7,9-10,12-13,15-16,20-21,24H,2,5,8,11,14,17-19,22-23H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | QAZDFNXZAHNDLR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|