C25H37N3O — CID 171117235
(5Z,8Z,11Z,14Z,17Z)-N-[2-(1H-imidazol-5-yl)ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 171117235) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-(1H-imidazol-5-yl)ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-(1H-imidazol-5-yl)ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 171117235 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-(1H-imidazol-5-yl)ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C25H37N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(29)27-21-20-24-22-26-23-28-24/h3-4,6-7,9-10,12-13,15-16,22-23H,2,5,8,11,14,17-21H2,1H3,(H,26,28)(H,27,29)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | POZOULOUCRVMCW-JLNKQSITSA-N |
| XLogP | 5.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|