C25H45N3O — CID 171117231
(Z)-N-[2-(1H-imidazol-5-yl)ethyl]icos-11-enamide (PubChem CID 171117231) has the molecular formula C25H45N3O and a molecular weight of 403.66 g/mol. Its IUPAC name is (Z)-N-[2-(1H-imidazol-5-yl)ethyl]icos-11-enamide.
| Compound Name | (Z)-N-[2-(1H-imidazol-5-yl)ethyl]icos-11-enamide |
|---|---|
| PubChem CID | 171117231 |
| Molecular Formula | C25H45N3O |
| Molecular Weight | 403.66 g/mol |
| Exact Mass | 403.36 |
| IUPAC Name | (Z)-N-[2-(1H-imidazol-5-yl)ethyl]icos-11-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C25H45N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(29)27-21-20-24-22-26-23-28-24/h9-10,22-23H,2-8,11-21H2,1H3,(H,26,28)(H,27,29)/b10-9- |
| InChIKey | RUBHWRWDEBRUIM-KTKRTIGZSA-N |
| XLogP | 6.89 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|