C11H20N4O — CID 19065170
6-amino-N-[2-(1H-imidazol-5-yl)ethyl]hexanamide (PubChem CID 19065170) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 6-amino-N-[2-(1H-imidazol-5-yl)ethyl]hexanamide.
| Compound Name | 6-amino-N-[2-(1H-imidazol-5-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 19065170 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 6-amino-N-[2-(1H-imidazol-5-yl)ethyl]hexanamide |
| SMILES | NCCCCCC(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C11H20N4O/c12-6-3-1-2-4-11(16)14-7-5-10-8-13-9-15-10/h8-9H,1-7,12H2,(H,13,15)(H,14,16) |
| InChIKey | RYEBECHCSCRVBJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|