C24H37NO2S — CID 71528458
S-[2-[[(5E,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl] ethanethioate (PubChem CID 71528458) has the molecular formula C24H37NO2S and a molecular weight of 403.63 g/mol. Its IUPAC name is S-[2-[[(5E,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl] ethanethioate.
| Compound Name | S-[2-[[(5E,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 71528458 |
| Molecular Formula | C24H37NO2S |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | S-[2-[[(5E,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl] ethanethioate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C/CCCC(=O)NCCSC(C)=O |
| InChI | InChI=1S/C24H37NO2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(27)25-21-22-28-23(2)26/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-22H2,1-2H3,(H,25,27)/b5-4-,8-7-,11-10-,14-13-,17-16+ |
| InChIKey | XZMAUGFTVCRIER-DHBIHFIGSA-N |
| XLogP | 6.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|