C31H48N2O4S2 — CID 78091912
5-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyldisulfanyl]ethylamino]-5-oxopentanoic acid (PubChem CID 78091912) has the molecular formula C31H48N2O4S2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 5-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyldisulfanyl]ethylamino]-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyldisulfanyl]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 78091912 |
| Molecular Formula | C31H48N2O4S2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 5-[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyldisulfanyl]ethylamino]-5-oxopentanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCSSCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C31H48N2O4S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-29(34)32-25-27-38-39-28-26-33-30(35)23-21-24-31(36)37/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-28H2,1H3,(H,32,34)(H,33,35)(H,36,37) |
| InChIKey | FGBYLVYJPPNZRD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|