C12H25NO3S2 — CID 144548033
ethane;5-oxo-5-[2-(propyldisulfanyl)ethylamino]pentanoic acid (PubChem CID 144548033) has the molecular formula C12H25NO3S2 and a molecular weight of 295.47 g/mol. Its IUPAC name is ethane;5-oxo-5-[2-(propyldisulfanyl)ethylamino]pentanoic acid.
| Compound Name | ethane;5-oxo-5-[2-(propyldisulfanyl)ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 144548033 |
| Molecular Formula | C12H25NO3S2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethane;5-oxo-5-[2-(propyldisulfanyl)ethylamino]pentanoic acid |
| SMILES | CC.CCCSSCCNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C10H19NO3S2.C2H6/c1-2-7-15-16-8-6-11-9(12)4-3-5-10(13)14;1-2/h2-8H2,1H3,(H,11,12)(H,13,14);1-2H3 |
| InChIKey | AJDRGTWKIFSASM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|