C19H29N3O2S2 — CID 121369786
N-[2-[2-[[(Z)-hept-4-enoyl]amino]ethyldisulfanyl]-2-methylpropyl]pyridine-3-carboxamide (PubChem CID 121369786) has the molecular formula C19H29N3O2S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is N-[2-[2-[[(Z)-hept-4-enoyl]amino]ethyldisulfanyl]-2-methylpropyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[2-[[(Z)-hept-4-enoyl]amino]ethyldisulfanyl]-2-methylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121369786 |
| Molecular Formula | C19H29N3O2S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[2-[2-[[(Z)-hept-4-enoyl]amino]ethyldisulfanyl]-2-methylpropyl]pyridine-3-carboxamide |
| SMILES | CC/C=C\CCC(=O)NCCSSC(C)(C)CNC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H29N3O2S2/c1-4-5-6-7-10-17(23)21-12-13-25-26-19(2,3)15-22-18(24)16-9-8-11-20-14-16/h5-6,8-9,11,14H,4,7,10,12-13,15H2,1-3H3,(H,21,23)(H,22,24)/b6-5- |
| InChIKey | BSIXTVQVCNACNK-WAYWQWQTSA-N |
| XLogP | 3.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|