C37H53N3O6 — CID 70306246
3-(1,1-dihydroxypropan-2-yl)-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-(pyridine-3-carbonylamino)hexanoic acid (PubChem CID 70306246) has the molecular formula C37H53N3O6 and a molecular weight of 635.85 g/mol. Its IUPAC name is 3-(1,1-dihydroxypropan-2-yl)-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-(pyridine-3-carbonylamino)hexanoic acid.
| Compound Name | 3-(1,1-dihydroxypropan-2-yl)-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-(pyridine-3-carbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 70306246 |
| Molecular Formula | C37H53N3O6 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.39 |
| IUPAC Name | 3-(1,1-dihydroxypropan-2-yl)-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-(pyridine-3-carbonylamino)hexanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCC(C(NC(=O)c1cccnc1)C(=O)O)C(C)C(O)O |
| InChI | InChI=1S/C37H53N3O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-33(41)39-28-23-25-32(30(2)36(43)44)34(37(45)46)40-35(42)31-24-22-27-38-29-31/h4-5,7-8,10-11,13-14,16-17,19-20,22,24,27,29-30,32,34,36,43-44H,3,6,9,12,15,18,21,23,25-26,28H2,1-2H3,(H,39,41)(H,40,42)(H,45,46)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | HPHBLTGHYFFBEM-JDPCYWKWSA-N |
| XLogP | 6.20 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|