C10H12N2O4 — CID 843815
(2R,3S)-3-hydroxy-2-(pyridine-3-carbonylamino)butanoic acid (PubChem CID 843815) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-(pyridine-3-carbonylamino)butanoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-(pyridine-3-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 843815 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-(pyridine-3-carbonylamino)butanoic acid |
| SMILES | C[C@H](O)[C@@H](NC(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C10H12N2O4/c1-6(13)8(10(15)16)12-9(14)7-3-2-4-11-5-7/h2-6,8,13H,1H3,(H,12,14)(H,15,16)/t6-,8+/m0/s1 |
| InChIKey | QCKGJVLCGHIGBN-POYBYMJQSA-N |
| XLogP | -0.35 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |