C10H13N2O4+ — CID 3431523
3-hydroxy-2-(pyridin-1-ium-3-carbonylamino)butanoic acid (PubChem CID 3431523) has the molecular formula C10H13N2O4+ and a molecular weight of 225.22 g/mol. Its IUPAC name is 3-hydroxy-2-(pyridin-1-ium-3-carbonylamino)butanoic acid.
| Compound Name | 3-hydroxy-2-(pyridin-1-ium-3-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 3431523 |
| Molecular Formula | C10H13N2O4+ |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-hydroxy-2-(pyridin-1-ium-3-carbonylamino)butanoic acid |
| SMILES | CC(O)C(NC(=O)c1ccc[nH+]c1)C(=O)O |
| InChI | InChI=1S/C10H12N2O4/c1-6(13)8(10(15)16)12-9(14)7-3-2-4-11-5-7/h2-6,8,13H,1H3,(H,12,14)(H,15,16)/p+1 |
| InChIKey | QCKGJVLCGHIGBN-UHFFFAOYSA-O |
| XLogP | -0.94 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |