C11H15N2O3+ — CID 3988388
3-methyl-2-(pyridin-1-ium-3-carbonylamino)butanoic acid (PubChem CID 3988388) has the molecular formula C11H15N2O3+ and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-methyl-2-(pyridin-1-ium-3-carbonylamino)butanoic acid.
| Compound Name | 3-methyl-2-(pyridin-1-ium-3-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 3988388 |
| Molecular Formula | C11H15N2O3+ |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-methyl-2-(pyridin-1-ium-3-carbonylamino)butanoic acid |
| SMILES | CC(C)C(NC(=O)c1ccc[nH+]c1)C(=O)O |
| InChI | InChI=1S/C11H14N2O3/c1-7(2)9(11(15)16)13-10(14)8-4-3-5-12-6-8/h3-7,9H,1-2H3,(H,13,14)(H,15,16)/p+1 |
| InChIKey | QBWUAJGXNZOAQO-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |