C13H16N2O4 — CID 61137378
(2S)-2-[(4-carbamoylbenzoyl)amino]-3-methylbutanoic acid (PubChem CID 61137378) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2S)-2-[(4-carbamoylbenzoyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(4-carbamoylbenzoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61137378 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2S)-2-[(4-carbamoylbenzoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(C(N)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O4/c1-7(2)10(13(18)19)15-12(17)9-5-3-8(4-6-9)11(14)16/h3-7,10H,1-2H3,(H2,14,16)(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | UIVSEMVNGPVEFR-JTQLQIEISA-N |
| XLogP | 0.62 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |