C11H15ClN2O3 — CID 52993255
3-methyl-2-(pyridine-3-carbonylamino)butanoic acid;hydrochloride (PubChem CID 52993255) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-methyl-2-(pyridine-3-carbonylamino)butanoic acid;hydrochloride.
| Compound Name | 3-methyl-2-(pyridine-3-carbonylamino)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 52993255 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-methyl-2-(pyridine-3-carbonylamino)butanoic acid;hydrochloride |
| SMILES | CC(C)C(NC(=O)c1cccnc1)C(=O)O.Cl |
| InChI | InChI=1S/C11H14N2O3.ClH/c1-7(2)9(11(15)16)13-10(14)8-4-3-5-12-6-8;/h3-7,9H,1-2H3,(H,13,14)(H,15,16);1H |
| InChIKey | ZYZDRXVFRXHFRI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |