C33H45N3O6 — CID 123806616
3-[2-(icosa-5,8,11,14,17-pentaenoylamino)propanoyloxy]-2-(pyridine-3-carbonylamino)butanoic acid (PubChem CID 123806616) has the molecular formula C33H45N3O6 and a molecular weight of 579.74 g/mol. Its IUPAC name is 3-[2-(icosa-5,8,11,14,17-pentaenoylamino)propanoyloxy]-2-(pyridine-3-carbonylamino)butanoic acid.
| Compound Name | 3-[2-(icosa-5,8,11,14,17-pentaenoylamino)propanoyloxy]-2-(pyridine-3-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 123806616 |
| Molecular Formula | C33H45N3O6 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | 3-[2-(icosa-5,8,11,14,17-pentaenoylamino)propanoyloxy]-2-(pyridine-3-carbonylamino)butanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NC(C)C(=O)OC(C)C(NC(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C33H45N3O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-29(37)35-26(2)33(41)42-27(3)30(32(39)40)36-31(38)28-22-21-24-34-25-28/h5-6,8-9,11-12,14-15,17-18,21-22,24-27,30H,4,7,10,13,16,19-20,23H2,1-3H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | BQGBBSQBAGDLDY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|