C26H37NO4 — CID 70293088
2-(pyridine-3-carbonyloxy)icosa-8,11,14-trienoic acid (PubChem CID 70293088) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-(pyridine-3-carbonyloxy)icosa-8,11,14-trienoic acid.
| Compound Name | 2-(pyridine-3-carbonyloxy)icosa-8,11,14-trienoic acid |
|---|---|
| PubChem CID | 70293088 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 2-(pyridine-3-carbonyloxy)icosa-8,11,14-trienoic acid |
| SMILES | CCCCCC=CCC=CCC=CCCCCCC(OC(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C26H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-24(25(28)29)31-26(30)23-19-18-21-27-22-23/h6-7,9-10,12-13,18-19,21-22,24H,2-5,8,11,14-17,20H2,1H3,(H,28,29) |
| InChIKey | ZHFQNPWYDIFULO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|